C36H42N4O4 — CID 6689839
1-benzyl-3-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]urea (PubChem CID 6689839) has the molecular formula C36H42N4O4 and a molecular weight of 594.76 g/mol. Its IUPAC name is 1-benzyl-3-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]urea.
| Compound Name | 1-benzyl-3-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6689839 |
| Molecular Formula | C36H42N4O4 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | 1-benzyl-3-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]urea |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(CNC(=O)NCc3ccccc3)cc2)O[C@H]1CN(C)CCc1ccccn1 |
| InChI | InChI=1S/C36H42N4O4/c1-26-33(24-40(2)21-19-32-10-6-7-20-37-32)43-35(44-34(26)30-15-13-29(25-41)14-16-30)31-17-11-28(12-18-31)23-39-36(42)38-22-27-8-4-3-5-9-27/h3-18,20,26,33-35,41H,19,21-25H2,1-2H3,(H2,38,39,42)/t26-,33+,34?,35+/m1/s1 |
| InChIKey | GDXZPOSMTBCGRW-ZZILEJTHSA-N |
| XLogP | 5.54 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |