C35H34F5N3O4 — CID 6689823
2,3,4,5,6-pentafluoro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide (PubChem CID 6689823) has the molecular formula C35H34F5N3O4 and a molecular weight of 655.66 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6689823 |
| Molecular Formula | C35H34F5N3O4 |
| Molecular Weight | 655.66 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide |
| SMILES | C[C@@H]1[C@H](CN(C)CCc2ccccn2)O[C@H](c2ccc(CNC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C35H34F5N3O4/c1-20-26(18-43(2)16-14-25-5-3-4-15-41-25)46-35(47-33(20)23-10-8-22(19-44)9-11-23)24-12-6-21(7-13-24)17-42-34(45)27-28(36)30(38)32(40)31(39)29(27)37/h3-13,15,20,26,33,35,44H,14,16-19H2,1-2H3,(H,42,45)/t20-,26+,33+,35+/m1/s1 |
| InChIKey | ZTXPABQSXDAMPW-WOCKMILTSA-N |
| XLogP | 6.17 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|