C32H40N4O6 — CID 6705607
ethyl 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate (PubChem CID 6705607) has the molecular formula C32H40N4O6 and a molecular weight of 576.69 g/mol. Its IUPAC name is ethyl 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 6705607 |
| Molecular Formula | C32H40N4O6 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | ethyl 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CN(C)CCc3ccccn3)O2)cc1 |
| InChI | InChI=1S/C32H40N4O6/c1-4-40-29(38)19-34-32(39)35-27-14-12-25(13-15-27)31-41-28(20-36(3)18-16-26-7-5-6-17-33-26)22(2)30(42-31)24-10-8-23(21-37)9-11-24/h5-15,17,22,28,30-31,37H,4,16,18-21H2,1-3H3,(H2,34,35,39)/t22-,28+,30?,31+/m1/s1 |
| InChIKey | AVZZYFIQLDIXEQ-FITNWEAKSA-N |
| XLogP | 4.22 |
| TPSA | 122.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |