C32H39N3O6 — CID 6704375
ethyl 2-[[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate (PubChem CID 6704375) has the molecular formula C32H39N3O6 and a molecular weight of 561.68 g/mol. Its IUPAC name is ethyl 2-[[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 6704375 |
| Molecular Formula | C32H39N3O6 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | ethyl 2-[[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CN(C)Cc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C32H39N3O6/c1-4-39-29(37)18-33-32(38)34-27-16-14-26(15-17-27)31-40-28(20-35(3)19-23-8-6-5-7-9-23)22(2)30(41-31)25-12-10-24(21-36)11-13-25/h5-17,22,28,30-31,36H,4,18-21H2,1-3H3,(H2,33,34,38)/t22-,28+,30?,31+/m0/s1 |
| InChIKey | QBEDNNCUXRUZJL-LOXXODFFSA-N |
| XLogP | 4.79 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |