C34H31F5N2O4 — CID 6705463
N-[4-[(2R,4R,5S,6S)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 6705463) has the molecular formula C34H31F5N2O4 and a molecular weight of 626.62 g/mol. Its IUPAC name is N-[4-[(2R,4R,5S,6S)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[4-[(2R,4R,5S,6S)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 6705463 |
| Molecular Formula | C34H31F5N2O4 |
| Molecular Weight | 626.62 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | N-[4-[(2R,4R,5S,6S)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | C[C@@H]1[C@H](CN(C)Cc2ccccc2)O[C@H](c2ccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C34H31F5N2O4/c1-19-25(17-41(2)16-20-6-4-3-5-7-20)44-34(45-32(19)22-10-8-21(18-42)9-11-22)23-12-14-24(15-13-23)40-33(43)26-27(35)29(37)31(39)30(38)28(26)36/h3-15,19,25,32,34,42H,16-18H2,1-2H3,(H,40,43)/t19-,25+,32+,34+/m1/s1 |
| InChIKey | GGYZDNDKIZMYKG-SBRJTKLXSA-N |
| XLogP | 7.05 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.62 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|