C34H38F3N3O5 — CID 6704364
(2S)-N-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 6704364) has the molecular formula C34H38F3N3O5 and a molecular weight of 625.69 g/mol. Its IUPAC name is (2S)-N-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6704364 |
| Molecular Formula | C34H38F3N3O5 |
| Molecular Weight | 625.69 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | (2S)-N-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(NC(=O)[C@@H]3CCCN3C(=O)C(F)(F)F)cc2)O[C@@H]1CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C34H38F3N3O5/c1-22-29(20-39(2)19-23-7-4-3-5-8-23)44-32(45-30(22)25-12-10-24(21-41)11-13-25)26-14-16-27(17-15-26)38-31(42)28-9-6-18-40(28)33(43)34(35,36)37/h3-5,7-8,10-17,22,28-30,32,41H,6,9,18-21H2,1-2H3,(H,38,42)/t22-,28-,29+,30?,32+/m0/s1 |
| InChIKey | NRADQFKIKFEIPX-OLEMVMFDSA-N |
| XLogP | 5.59 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.69 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |