C32H33F3N2O5S — CID 6704166
(2S)-N-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 6704166) has the molecular formula C32H33F3N2O5S and a molecular weight of 614.69 g/mol. Its IUPAC name is (2S)-N-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6704166 |
| Molecular Formula | C32H33F3N2O5S |
| Molecular Weight | 614.69 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | (2S)-N-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(NC(=O)[C@@H]3CCCN3C(=O)C(F)(F)F)cc2)O[C@@H]1CSc1ccccc1 |
| InChI | InChI=1S/C32H33F3N2O5S/c1-20-27(19-43-25-6-3-2-4-7-25)41-30(42-28(20)22-11-9-21(18-38)10-12-22)23-13-15-24(16-14-23)36-29(39)26-8-5-17-37(26)31(40)32(33,34)35/h2-4,6-7,9-16,20,26-28,30,38H,5,8,17-19H2,1H3,(H,36,39)/t20-,26-,27+,28?,30+/m0/s1 |
| InChIKey | LESARNCWXAUKGW-QIWPMVDFSA-N |
| XLogP | 6.25 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.69 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |