C30H31F3N4O5S — CID 6688307
(2S)-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 6688307) has the molecular formula C30H31F3N4O5S and a molecular weight of 616.66 g/mol. Its IUPAC name is (2S)-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6688307 |
| Molecular Formula | C30H31F3N4O5S |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | (2S)-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)[C@@H]3CCCN3C(=O)C(F)(F)F)c2)O[C@H]1CSc1ncccn1 |
| InChI | InChI=1S/C30H31F3N4O5S/c1-18-24(17-43-29-34-12-4-13-35-29)41-27(42-25(18)20-10-8-19(16-38)9-11-20)21-5-2-6-22(15-21)36-26(39)23-7-3-14-37(23)28(40)30(31,32)33/h2,4-6,8-13,15,18,23-25,27,38H,3,7,14,16-17H2,1H3,(H,36,39)/t18-,23+,24+,25?,27+/m1/s1 |
| InChIKey | DCRLRHQMYMKMPL-ZZIHMHMVSA-N |
| XLogP | 5.04 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |