C29H29F3N4O5S — CID 6694010
(2S)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 6694010) has the molecular formula C29H29F3N4O5S and a molecular weight of 602.64 g/mol. Its IUPAC name is (2S)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6694010 |
| Molecular Formula | C29H29F3N4O5S |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | (2S)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccc([C@@H]2O[C@H](CSc3ncccn3)C[C@H](c3ccc(CO)cc3)O2)c1)[C@@H]1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C29H29F3N4O5S/c30-29(31,32)27(39)36-13-2-6-23(36)25(38)35-21-5-1-4-20(14-21)26-40-22(17-42-28-33-11-3-12-34-28)15-24(41-26)19-9-7-18(16-37)8-10-19/h1,3-5,7-12,14,22-24,26,37H,2,6,13,15-17H2,(H,35,38)/t22-,23-,24+,26+/m0/s1 |
| InChIKey | ADCHOTLPCRVKNH-HPUZDQILSA-N |
| XLogP | 4.80 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |