C24H22Cl3N3O4S — CID 6694005
2,2,2-trichloro-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6694005) has the molecular formula C24H22Cl3N3O4S and a molecular weight of 554.88 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6694005 |
| Molecular Formula | C24H22Cl3N3O4S |
| Molecular Weight | 554.88 g/mol |
| Exact Mass | 553.04 |
| IUPAC Name | 2,2,2-trichloro-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | O=C(Nc1cccc([C@@H]2O[C@H](CSc3ncccn3)C[C@H](c3ccc(CO)cc3)O2)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C24H22Cl3N3O4S/c25-24(26,27)22(32)30-18-4-1-3-17(11-18)21-33-19(14-35-23-28-9-2-10-29-23)12-20(34-21)16-7-5-15(13-31)6-8-16/h1-11,19-21,31H,12-14H2,(H,30,32)/t19-,20+,21+/m0/s1 |
| InChIKey | IJNGHMSZQOIYKJ-PWRODBHTSA-N |
| XLogP | 5.62 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.88 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|