C22H24Cl3NO5S — CID 6698621
2,2,2-trichloro-N-[3-[(2R,4R,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6698621) has the molecular formula C22H24Cl3NO5S and a molecular weight of 520.86 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[3-[(2R,4R,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[3-[(2R,4R,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6698621 |
| Molecular Formula | C22H24Cl3NO5S |
| Molecular Weight | 520.86 g/mol |
| Exact Mass | 519.04 |
| IUPAC Name | 2,2,2-trichloro-N-[3-[(2R,4R,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | O=C(Nc1cccc([C@H]2O[C@@H](CSCCO)C[C@@H](c3ccc(CO)cc3)O2)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H24Cl3NO5S/c23-22(24,25)21(29)26-17-3-1-2-16(10-17)20-30-18(13-32-9-8-27)11-19(31-20)15-6-4-14(12-28)5-7-15/h1-7,10,18-20,27-28H,8-9,11-13H2,(H,26,29)/t18-,19+,20+/m1/s1 |
| InChIKey | ACVYJFXFLRFGIK-AABGKKOBSA-N |
| XLogP | 4.76 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|