C23H30N2O5S — CID 6679795
1-ethyl-3-[3-[(4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6679795) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is 1-ethyl-3-[3-[(4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-ethyl-3-[3-[(4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6679795 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1-ethyl-3-[3-[(4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | CCNC(=O)Nc1cccc(C2O[C@H](CSCCO)C[C@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C23H30N2O5S/c1-2-24-23(28)25-19-5-3-4-18(12-19)22-29-20(15-31-11-10-26)13-21(30-22)17-8-6-16(14-27)7-9-17/h3-9,12,20-22,26-27H,2,10-11,13-15H2,1H3,(H2,24,25,28)/t20-,21+,22?/m0/s1 |
| InChIKey | BXYHJMIUCBIFLF-UGGDCYSXSA-N |
| XLogP | 3.59 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|