C33H41N3O6S — CID 6672334
N'-(2-aminophenyl)-N-[3-[(2R,4R,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide (PubChem CID 6672334) has the molecular formula C33H41N3O6S and a molecular weight of 607.77 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2R,4R,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2R,4R,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
|---|---|
| PubChem CID | 6672334 |
| Molecular Formula | C33H41N3O6S |
| Molecular Weight | 607.77 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2R,4R,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)Nc1cccc([C@H]2O[C@@H](CSCCO)C[C@@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C33H41N3O6S/c34-28-9-4-5-10-29(28)36-32(40)12-3-1-2-11-31(39)35-26-8-6-7-25(19-26)33-41-27(22-43-18-17-37)20-30(42-33)24-15-13-23(21-38)14-16-24/h4-10,13-16,19,27,30,33,37-38H,1-3,11-12,17-18,20-22,34H2,(H,35,39)(H,36,40)/t27-,30+,33+/m1/s1 |
| InChIKey | BBZIHOZFFNATLX-DPJKJRSDSA-N |
| XLogP | 5.56 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.77 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|