C40H47N3O6S — CID 6672394
N'-(2-aminophenyl)-N-[[3-[3-[(2R,4R,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide (PubChem CID 6672394) has the molecular formula C40H47N3O6S and a molecular weight of 697.90 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[3-[(2R,4R,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[3-[(2R,4R,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 6672394 |
| Molecular Formula | C40H47N3O6S |
| Molecular Weight | 697.90 g/mol |
| Exact Mass | 697.32 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[3-[(2R,4R,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)NCc1cccc(-c2cccc([C@H]3O[C@@H](CSCCO)C[C@@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C40H47N3O6S/c41-35-12-4-5-13-36(35)43-39(47)15-3-1-2-14-38(46)42-25-29-8-6-9-31(22-29)32-10-7-11-33(23-32)40-48-34(27-50-21-20-44)24-37(49-40)30-18-16-28(26-45)17-19-30/h4-13,16-19,22-23,34,37,40,44-45H,1-3,14-15,20-21,24-27,41H2,(H,42,46)(H,43,47)/t34-,37+,40+/m1/s1 |
| InChIKey | BUTXNTUMPJIJGM-DWSIONMVSA-N |
| XLogP | 6.90 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.90 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|