C38H43N3O6S — CID 4011855
N'-(2-aminophenyl)-N-[[3-[3-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide (PubChem CID 4011855) has the molecular formula C38H43N3O6S and a molecular weight of 669.84 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[3-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[3-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 4011855 |
| Molecular Formula | C38H43N3O6S |
| Molecular Weight | 669.84 g/mol |
| Exact Mass | 669.29 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[3-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCC(=O)NCc1cccc(-c2cccc(C3OC(CSCCO)CC(c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C38H43N3O6S/c39-33-10-1-2-11-34(33)41-37(45)13-5-12-36(44)40-23-27-6-3-7-29(20-27)30-8-4-9-31(21-30)38-46-32(25-48-19-18-42)22-35(47-38)28-16-14-26(24-43)15-17-28/h1-4,6-11,14-17,20-21,32,35,38,42-43H,5,12-13,18-19,22-25,39H2,(H,40,44)(H,41,45) |
| InChIKey | KIEPZJGFNRMYEE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.84 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|