C41H49N3O6S — CID 4023681
N'-(2-aminophenyl)-N-[[3-[3-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide (PubChem CID 4023681) has the molecular formula C41H49N3O6S and a molecular weight of 711.93 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[3-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[3-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 4023681 |
| Molecular Formula | C41H49N3O6S |
| Molecular Weight | 711.93 g/mol |
| Exact Mass | 711.33 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[3-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)NCc1cccc(-c2cccc(C3OC(CSCCO)CC(c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C41H49N3O6S/c42-36-13-5-6-14-37(36)44-40(48)16-4-2-1-3-15-39(47)43-26-30-9-7-10-32(23-30)33-11-8-12-34(24-33)41-49-35(28-51-22-21-45)25-38(50-41)31-19-17-29(27-46)18-20-31/h5-14,17-20,23-24,35,38,41,45-46H,1-4,15-16,21-22,25-28,42H2,(H,43,47)(H,44,48) |
| InChIKey | PSDUOGVNCIKSLM-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.93 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|