C45H49N3O5S — CID 6672805
N'-(2-aminophenyl)-N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide (PubChem CID 6672805) has the molecular formula C45H49N3O5S and a molecular weight of 743.97 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 6672805 |
| Molecular Formula | C45H49N3O5S |
| Molecular Weight | 743.97 g/mol |
| Exact Mass | 743.34 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)NCc1cccc(-c2ccc([C@H]3O[C@@H](CSc4ccccc4)C[C@@H](c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C45H49N3O5S/c46-40-15-8-9-16-41(40)48-44(51)18-7-2-1-6-17-43(50)47-29-33-11-10-12-37(27-33)34-23-25-36(26-24-34)45-52-38(31-54-39-13-4-3-5-14-39)28-42(53-45)35-21-19-32(30-49)20-22-35/h3-5,8-16,19-27,38,42,45,49H,1-2,6-7,17-18,28-31,46H2,(H,47,50)(H,48,51)/t38-,42+,45+/m1/s1 |
| InChIKey | JJBCNVZIUCDGGT-RNXNIYJNSA-N |
| XLogP | 9.36 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.97 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|