C42H45N5O5S — CID 3928791
N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide (PubChem CID 3928791) has the molecular formula C42H45N5O5S and a molecular weight of 731.92 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 3928791 |
| Molecular Formula | C42H45N5O5S |
| Molecular Weight | 731.92 g/mol |
| Exact Mass | 731.31 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)NCc1cccc(-c2ccc(C3OC(CSc4ncccn4)CC(c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C42H45N5O5S/c43-36-10-4-5-11-37(36)47-40(50)13-3-1-2-12-39(49)46-26-30-8-6-9-34(24-30)31-18-20-33(21-19-31)41-51-35(28-53-42-44-22-7-23-45-42)25-38(52-41)32-16-14-29(27-48)15-17-32/h4-11,14-24,35,38,41,48H,1-3,12-13,25-28,43H2,(H,46,49)(H,47,50) |
| InChIKey | IOQZAHLFSNQKQA-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.92 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|