C41H43N5O5S — CID 6672955
N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide (PubChem CID 6672955) has the molecular formula C41H43N5O5S and a molecular weight of 717.89 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 6672955 |
| Molecular Formula | C41H43N5O5S |
| Molecular Weight | 717.89 g/mol |
| Exact Mass | 717.30 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CSc3ncccn3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C41H43N5O5S/c42-35-10-3-4-11-36(35)46-39(49)13-6-5-12-38(48)45-25-32-8-1-2-9-34(32)29-18-20-31(21-19-29)40-50-33(27-52-41-43-22-7-23-44-41)24-37(51-40)30-16-14-28(26-47)15-17-30/h1-4,7-11,14-23,33,37,40,47H,5-6,12-13,24-27,42H2,(H,45,48)(H,46,49)/t33-,37+,40+/m1/s1 |
| InChIKey | PGGDJTLOPBWEIY-UHWXTCIZSA-N |
| XLogP | 7.37 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.89 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|