C36H40N4O6S — CID 4566428
N'-hydroxy-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide (PubChem CID 4566428) has the molecular formula C36H40N4O6S and a molecular weight of 656.81 g/mol. Its IUPAC name is N'-hydroxy-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 4566428 |
| Molecular Formula | C36H40N4O6S |
| Molecular Weight | 656.81 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | N'-hydroxy-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
| SMILES | O=C(CCCCCC(=O)NCc1ccccc1-c1ccc(C2OC(CSc3ncccn3)CC(c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C36H40N4O6S/c41-23-25-11-13-27(14-12-25)32-21-30(24-47-36-37-19-6-20-38-36)45-35(46-32)28-17-15-26(16-18-28)31-8-5-4-7-29(31)22-39-33(42)9-2-1-3-10-34(43)40-44/h4-8,11-20,30,32,35,41,44H,1-3,9-10,21-24H2,(H,39,42)(H,40,43) |
| InChIKey | CPZULOZHNMYVEX-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.81 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|