C37H41N3O7S — CID 3673634
N'-hydroxy-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide (PubChem CID 3673634) has the molecular formula C37H41N3O7S and a molecular weight of 671.82 g/mol. Its IUPAC name is N'-hydroxy-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 3673634 |
| Molecular Formula | C37H41N3O7S |
| Molecular Weight | 671.82 g/mol |
| Exact Mass | 671.27 |
| IUPAC Name | N'-hydroxy-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
| SMILES | O=C(CCCCCC(=O)NCc1ccccc1-c1ccc(C2OC(CSc3cccc[n+]3[O-])CC(c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C37H41N3O7S/c41-24-26-13-15-28(16-14-26)33-22-31(25-48-36-12-6-7-21-40(36)45)46-37(47-33)29-19-17-27(18-20-29)32-9-5-4-8-30(32)23-38-34(42)10-2-1-3-11-35(43)39-44/h4-9,12-21,31,33,37,41,44H,1-3,10-11,22-25H2,(H,38,42)(H,39,43) |
| InChIKey | DGMLQDPVTAAZSM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.82 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|