C38H43N3O6S — CID 4571301
6-acetamido-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide (PubChem CID 4571301) has the molecular formula C38H43N3O6S and a molecular weight of 669.84 g/mol. Its IUPAC name is 6-acetamido-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 4571301 |
| Molecular Formula | C38H43N3O6S |
| Molecular Weight | 669.84 g/mol |
| Exact Mass | 669.29 |
| IUPAC Name | 6-acetamido-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1cccc(-c2ccc(C3OC(CSc4cccc[n+]4[O-])CC(c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C38H43N3O6S/c1-27(43)39-20-5-2-3-10-36(44)40-24-29-8-7-9-33(22-29)30-16-18-32(19-17-30)38-46-34(26-48-37-11-4-6-21-41(37)45)23-35(47-38)31-14-12-28(25-42)13-15-31/h4,6-9,11-19,21-22,34-35,38,42H,2-3,5,10,20,23-26H2,1H3,(H,39,43)(H,40,44) |
| InChIKey | DLXJPJZBTJOHOB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 123.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.84 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|