C37H40N2O7S — CID 6673616
7-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid (PubChem CID 6673616) has the molecular formula C37H40N2O7S and a molecular weight of 656.80 g/mol. Its IUPAC name is 7-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid.
| Compound Name | 7-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 6673616 |
| Molecular Formula | C37H40N2O7S |
| Molecular Weight | 656.80 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | 7-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid |
| SMILES | O=C(O)CCCCCC(=O)NCc1cccc(-c2cccc([C@H]3O[C@@H](CSc4cccc[n+]4[O-])C[C@@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C37H40N2O7S/c40-24-26-15-17-28(18-16-26)33-22-32(25-47-35-13-4-5-19-39(35)44)45-37(46-33)31-11-7-10-30(21-31)29-9-6-8-27(20-29)23-38-34(41)12-2-1-3-14-36(42)43/h4-11,13,15-21,32-33,37,40H,1-3,12,14,22-25H2,(H,38,41)(H,42,43)/t32-,33+,37+/m1/s1 |
| InChIKey | QJLTUCAQJKOVRW-JRJABSJZSA-N |
| XLogP | 6.47 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.80 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|