C44H48N4O6S — CID 4539372
N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide (PubChem CID 4539372) has the molecular formula C44H48N4O6S and a molecular weight of 760.96 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 4539372 |
| Molecular Formula | C44H48N4O6S |
| Molecular Weight | 760.96 g/mol |
| Exact Mass | 760.33 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)NCc1cccc(-c2ccc(C3OC(CSc4cccc[n+]4[O-])CC(c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C44H48N4O6S/c45-38-12-5-6-13-39(38)47-42(51)15-4-2-1-3-14-41(50)46-28-32-10-9-11-36(26-32)33-21-23-35(24-22-33)44-53-37(30-55-43-16-7-8-25-48(43)52)27-40(54-44)34-19-17-31(29-49)18-20-34/h5-13,16-26,37,40,44,49H,1-4,14-15,27-30,45H2,(H,46,50)(H,47,51) |
| InChIKey | PNTXLAORUQGGJZ-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.96 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|