C35H38N4O6S — CID 6673555
N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 6673555) has the molecular formula C35H38N4O6S and a molecular weight of 642.78 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 6673555 |
| Molecular Formula | C35H38N4O6S |
| Molecular Weight | 642.78 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)Nc1cccc([C@H]2O[C@@H](CSc3cccc[n+]3[O-])C[C@@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C35H38N4O6S/c36-29-10-1-2-11-30(29)38-33(42)13-4-3-12-32(41)37-27-9-7-8-26(20-27)35-44-28(23-46-34-14-5-6-19-39(34)43)21-31(45-35)25-17-15-24(22-40)16-18-25/h1-2,5-11,14-20,28,31,35,40H,3-4,12-13,21-23,36H2,(H,37,41)(H,38,42)/t28-,31+,35+/m1/s1 |
| InChIKey | KVHDVNXYOXKFGE-VOGGTATGSA-N |
| XLogP | 5.87 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.78 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|