C31H37N3O6S — CID 5081187
6-acetamido-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanamide (PubChem CID 5081187) has the molecular formula C31H37N3O6S and a molecular weight of 579.72 g/mol. Its IUPAC name is 6-acetamido-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanamide.
| Compound Name | 6-acetamido-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 5081187 |
| Molecular Formula | C31H37N3O6S |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | 6-acetamido-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)Nc1cccc(C2OC(CSc3cccc[n+]3[O-])CC(c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C31H37N3O6S/c1-22(36)32-16-5-2-3-10-29(37)33-26-9-7-8-25(18-26)31-39-27(21-41-30-11-4-6-17-34(30)38)19-28(40-31)24-14-12-23(20-35)13-15-24/h4,6-9,11-15,17-18,27-28,31,35H,2-3,5,10,16,19-21H2,1H3,(H,32,36)(H,33,37) |
| InChIKey | ZZYZTGQQACMNEO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 123.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|