C34H35N3O6S — CID 4080411
1-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-3-(3-oxo-1-phenylbutan-2-yl)urea (PubChem CID 4080411) has the molecular formula C34H35N3O6S and a molecular weight of 613.74 g/mol. Its IUPAC name is 1-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-3-(3-oxo-1-phenylbutan-2-yl)urea.
| Compound Name | 1-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-3-(3-oxo-1-phenylbutan-2-yl)urea |
|---|---|
| PubChem CID | 4080411 |
| Molecular Formula | C34H35N3O6S |
| Molecular Weight | 613.74 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | 1-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-3-(3-oxo-1-phenylbutan-2-yl)urea |
| SMILES | CC(=O)C(Cc1ccccc1)NC(=O)Nc1cccc(C2OC(CSc3cccc[n+]3[O-])CC(c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C34H35N3O6S/c1-23(39)30(18-24-8-3-2-4-9-24)36-34(40)35-28-11-7-10-27(19-28)33-42-29(22-44-32-12-5-6-17-37(32)41)20-31(43-33)26-15-13-25(21-38)14-16-26/h2-17,19,29-31,33,38H,18,20-22H2,1H3,(H2,35,36,40) |
| InChIKey | GGZGEFKCBQBGBF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 123.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.74 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|