C35H37N3O7S — CID 6689353
methyl (2S)-2-[[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate (PubChem CID 6689353) has the molecular formula C35H37N3O7S and a molecular weight of 643.76 g/mol. Its IUPAC name is methyl (2S)-2-[[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6689353 |
| Molecular Formula | C35H37N3O7S |
| Molecular Weight | 643.76 g/mol |
| Exact Mass | 643.24 |
| IUPAC Name | methyl (2S)-2-[[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)Nc1cccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CSc3cccc[n+]3[O-])O2)c1 |
| InChI | InChI=1S/C35H37N3O7S/c1-23-30(22-46-31-13-6-7-18-38(31)42)44-34(45-32(23)26-16-14-25(21-39)15-17-26)27-11-8-12-28(20-27)36-35(41)37-29(33(40)43-2)19-24-9-4-3-5-10-24/h3-18,20,23,29-30,32,34,39H,19,21-22H2,1-2H3,(H2,36,37,41)/t23-,29+,30+,32?,34+/m1/s1 |
| InChIKey | UYAMHEHUBUEOSM-ALJCWYGXSA-N |
| XLogP | 5.30 |
| TPSA | 133.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.76 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|