C37H38N2O8S — CID 6690388
2-[[(2R,4R,5S,6S)-6-[4-(hydroxymethyl)phenyl]-2-[3-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoylamino]phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6690388) has the molecular formula C37H38N2O8S and a molecular weight of 670.78 g/mol. Its IUPAC name is 2-[[(2R,4R,5S,6S)-6-[4-(hydroxymethyl)phenyl]-2-[3-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoylamino]phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 2-[[(2R,4R,5S,6S)-6-[4-(hydroxymethyl)phenyl]-2-[3-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoylamino]phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6690388 |
| Molecular Formula | C37H38N2O8S |
| Molecular Weight | 670.78 g/mol |
| Exact Mass | 670.23 |
| IUPAC Name | 2-[[(2R,4R,5S,6S)-6-[4-(hydroxymethyl)phenyl]-2-[3-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoylamino]phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)Nc1cccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CSc3ccccc3C(=O)O)O2)c1 |
| InChI | InChI=1S/C37H38N2O8S/c1-23-31(22-48-32-14-7-6-13-29(32)34(41)42)46-36(47-33(23)26-17-15-25(21-40)16-18-26)27-11-8-12-28(20-27)38-37(44)39-30(35(43)45-2)19-24-9-4-3-5-10-24/h3-18,20,23,30-31,33,36,40H,19,21-22H2,1-2H3,(H,41,42)(H2,38,39,44)/t23-,30+,31+,33?,36+/m1/s1 |
| InChIKey | XNOGSLPGAHTSCB-LHTRPXSLSA-N |
| XLogP | 6.37 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.78 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |