C37H37N3O6S2 — CID 6685332
methyl (2S)-2-[[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate (PubChem CID 6685332) has the molecular formula C37H37N3O6S2 and a molecular weight of 683.85 g/mol. Its IUPAC name is methyl (2S)-2-[[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6685332 |
| Molecular Formula | C37H37N3O6S2 |
| Molecular Weight | 683.85 g/mol |
| Exact Mass | 683.21 |
| IUPAC Name | methyl (2S)-2-[[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)Nc1cccc([C@@H]2O[C@H](CSc3nc4ccccc4s3)[C@H](C)[C@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C37H37N3O6S2/c1-23-31(22-47-37-40-29-13-6-7-14-32(29)48-37)45-35(46-33(23)26-17-15-25(21-41)16-18-26)27-11-8-12-28(20-27)38-36(43)39-30(34(42)44-2)19-24-9-4-3-5-10-24/h3-18,20,23,30-31,33,35,41H,19,21-22H2,1-2H3,(H2,38,39,43)/t23-,30-,31+,33+,35+/m0/s1 |
| InChIKey | YAIILNSPDUMPEB-VXXRMWKTSA-N |
| XLogP | 7.28 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.85 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |