C29H31N3O4S2 — CID 6705848
1-[4-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-ethylurea (PubChem CID 6705848) has the molecular formula C29H31N3O4S2 and a molecular weight of 549.72 g/mol. Its IUPAC name is 1-[4-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-ethylurea.
| Compound Name | 1-[4-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 6705848 |
| Molecular Formula | C29H31N3O4S2 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 1-[4-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc([C@H]2O[C@@H](CSc3nc4ccccc4s3)[C@@H](C)[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C29H31N3O4S2/c1-3-30-28(34)31-22-14-12-21(13-15-22)27-35-24(17-37-29-32-23-6-4-5-7-25(23)38-29)18(2)26(36-27)20-10-8-19(16-33)9-11-20/h4-15,18,24,26-27,33H,3,16-17H2,1-2H3,(H2,30,31,34)/t18-,24+,26+,27+/m1/s1 |
| InChIKey | DWFZGVKVXVKHMG-AIRFCXSGSA-N |
| XLogP | 6.51 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |