C37H37N3O5S — CID 6705100
1-[4-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-ethylurea (PubChem CID 6705100) has the molecular formula C37H37N3O5S and a molecular weight of 635.79 g/mol. Its IUPAC name is 1-[4-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-ethylurea.
| Compound Name | 1-[4-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 6705100 |
| Molecular Formula | C37H37N3O5S |
| Molecular Weight | 635.79 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | 1-[4-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CSc3nc(-c4ccccc4)c(-c4ccccc4)o3)O2)cc1 |
| InChI | InChI=1S/C37H37N3O5S/c1-3-38-36(42)39-30-20-18-29(19-21-30)35-43-31(24(2)33(44-35)28-16-14-25(22-41)15-17-28)23-46-37-40-32(26-10-6-4-7-11-26)34(45-37)27-12-8-5-9-13-27/h4-21,24,31,33,35,41H,3,22-23H2,1-2H3,(H2,38,39,42)/t24-,31+,33?,35+/m0/s1 |
| InChIKey | LYIRUONIFMBXOB-VHZDNUGLSA-N |
| XLogP | 8.23 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.79 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |