C40H41N3O7S — CID 6692939
ethyl 2-[[4-[(2R,4R,5S,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]acetate (PubChem CID 6692939) has the molecular formula C40H41N3O7S and a molecular weight of 707.85 g/mol. Its IUPAC name is ethyl 2-[[4-[(2R,4R,5S,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[(2R,4R,5S,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 6692939 |
| Molecular Formula | C40H41N3O7S |
| Molecular Weight | 707.85 g/mol |
| Exact Mass | 707.27 |
| IUPAC Name | ethyl 2-[[4-[(2R,4R,5S,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1ccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CSc3nc(-c4ccccc4)c(-c4ccccc4)o3)O2)cc1 |
| InChI | InChI=1S/C40H41N3O7S/c1-3-47-34(45)23-42-39(46)41-22-27-14-20-32(21-15-27)38-48-33(26(2)36(49-38)31-18-16-28(24-44)17-19-31)25-51-40-43-35(29-10-6-4-7-11-29)37(50-40)30-12-8-5-9-13-30/h4-21,26,33,36,38,44H,3,22-25H2,1-2H3,(H2,41,42,46)/t26-,33+,36?,38+/m1/s1 |
| InChIKey | KSVSOAUETPOCJQ-CTTDIJDGSA-N |
| XLogP | 7.45 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.85 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |