C43H41N3O5S — CID 6687197
1-benzyl-3-[[4-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]urea (PubChem CID 6687197) has the molecular formula C43H41N3O5S and a molecular weight of 711.88 g/mol. Its IUPAC name is 1-benzyl-3-[[4-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]urea.
| Compound Name | 1-benzyl-3-[[4-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6687197 |
| Molecular Formula | C43H41N3O5S |
| Molecular Weight | 711.88 g/mol |
| Exact Mass | 711.28 |
| IUPAC Name | 1-benzyl-3-[[4-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]urea |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(CNC(=O)NCc3ccccc3)cc2)O[C@@H]1CSc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C43H41N3O5S/c1-29-37(28-52-43-46-38(33-13-7-3-8-14-33)40(51-43)34-15-9-4-10-16-34)49-41(50-39(29)35-21-19-32(27-47)20-22-35)36-23-17-31(18-24-36)26-45-42(48)44-25-30-11-5-2-6-12-30/h2-24,29,37,39,41,47H,25-28H2,1H3,(H2,44,45,48)/t29-,37+,39?,41+/m0/s1 |
| InChIKey | GAMPDQMSHSVODZ-HXHBXWBDSA-N |
| XLogP | 9.08 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.88 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |