C41H38N2O4S — CID 6687198
[4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-6-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6687198) has the molecular formula C41H38N2O4S and a molecular weight of 654.83 g/mol. Its IUPAC name is [4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-6-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-6-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6687198 |
| Molecular Formula | C41H38N2O4S |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.26 |
| IUPAC Name | [4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-6-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CN)c3)cc2)O[C@@H]1CSc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C41H38N2O4S/c1-27-36(26-48-41-43-37(31-10-4-2-5-11-31)39(47-41)32-12-6-3-7-13-32)45-40(46-38(27)33-17-15-28(25-44)16-18-33)34-21-19-30(20-22-34)35-14-8-9-29(23-35)24-42/h2-23,27,36,38,40,44H,24-26,42H2,1H3/t27-,36+,38?,40+/m0/s1 |
| InChIKey | QGUPPCYOPLHCDK-CCUCZVOCSA-N |
| XLogP | 9.21 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |