C34H32N2O4S — CID 6680762
[4-[(4R,5R,6S)-2-(3-aminophenyl)-6-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6680762) has the molecular formula C34H32N2O4S and a molecular weight of 564.71 g/mol. Its IUPAC name is [4-[(4R,5R,6S)-2-(3-aminophenyl)-6-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(4R,5R,6S)-2-(3-aminophenyl)-6-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6680762 |
| Molecular Formula | C34H32N2O4S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | [4-[(4R,5R,6S)-2-(3-aminophenyl)-6-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)OC(c2cccc(N)c2)O[C@@H]1CSc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C34H32N2O4S/c1-22-29(21-41-34-36-30(24-9-4-2-5-10-24)32(40-34)25-11-6-3-7-12-25)38-33(27-13-8-14-28(35)19-27)39-31(22)26-17-15-23(20-37)16-18-26/h2-19,22,29,31,33,37H,20-21,35H2,1H3/t22-,29+,31?,33?/m0/s1 |
| InChIKey | GKNLLTUPQWIOEY-AWZDGQTRSA-N |
| XLogP | 7.67 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|