C41H31F5N2O5S — CID 6692904
N-[3-[(2R,4R,5S,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 6692904) has the molecular formula C41H31F5N2O5S and a molecular weight of 758.77 g/mol. Its IUPAC name is N-[3-[(2R,4R,5S,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[3-[(2R,4R,5S,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 6692904 |
| Molecular Formula | C41H31F5N2O5S |
| Molecular Weight | 758.77 g/mol |
| Exact Mass | 758.19 |
| IUPAC Name | N-[3-[(2R,4R,5S,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | C[C@@H]1[C@H](CSc2nc(-c3ccccc3)c(-c3ccccc3)o2)O[C@H](c2cccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C41H31F5N2O5S/c1-22-29(21-54-41-48-36(24-9-4-2-5-10-24)38(53-41)25-11-6-3-7-12-25)51-40(52-37(22)26-17-15-23(20-49)16-18-26)27-13-8-14-28(19-27)47-39(50)30-31(42)33(44)35(46)34(45)32(30)43/h2-19,22,29,37,40,49H,20-21H2,1H3,(H,47,50)/t22-,29+,37+,40+/m1/s1 |
| InChIKey | DIVJXMOTXQVUQA-JKHPLHQQSA-N |
| XLogP | 10.03 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.77 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|