C32H26F5NO4S — CID 6688076
2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 6688076) has the molecular formula C32H26F5NO4S and a molecular weight of 615.62 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 6688076 |
| Molecular Formula | C32H26F5NO4S |
| Molecular Weight | 615.62 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | C[C@@H]1[C@H](CSc2ccccc2)O[C@H](c2cccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C32H26F5NO4S/c1-17-23(16-43-22-8-3-2-4-9-22)41-32(42-30(17)19-12-10-18(15-39)11-13-19)20-6-5-7-21(14-20)38-31(40)24-25(33)27(35)29(37)28(36)26(24)34/h2-14,17,23,30,32,39H,15-16H2,1H3,(H,38,40)/t17-,23+,30+,32+/m1/s1 |
| InChIKey | DCMWFLZGSZCLIK-JDWGYPCLSA-N |
| XLogP | 7.71 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.62 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|