C35H37N3O5S — CID 6691195
N-[4-[[(2R,4R,5S,6S)-2-[3-(benzylcarbamoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]phenyl]acetamide (PubChem CID 6691195) has the molecular formula C35H37N3O5S and a molecular weight of 611.76 g/mol. Its IUPAC name is N-[4-[[(2R,4R,5S,6S)-2-[3-(benzylcarbamoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]phenyl]acetamide.
| Compound Name | N-[4-[[(2R,4R,5S,6S)-2-[3-(benzylcarbamoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 6691195 |
| Molecular Formula | C35H37N3O5S |
| Molecular Weight | 611.76 g/mol |
| Exact Mass | 611.25 |
| IUPAC Name | N-[4-[[(2R,4R,5S,6S)-2-[3-(benzylcarbamoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(SC[C@@H]2O[C@H](c3cccc(NC(=O)NCc4ccccc4)c3)OC(c3ccc(CO)cc3)[C@@H]2C)cc1 |
| InChI | InChI=1S/C35H37N3O5S/c1-23-32(22-44-31-17-15-29(16-18-31)37-24(2)40)42-34(43-33(23)27-13-11-26(21-39)12-14-27)28-9-6-10-30(19-28)38-35(41)36-20-25-7-4-3-5-8-25/h3-19,23,32-34,39H,20-22H2,1-2H3,(H,37,40)(H2,36,38,41)/t23-,32+,33?,34+/m1/s1 |
| InChIKey | ZWBMPRWFKRJQML-ALDGNEJWSA-N |
| XLogP | 7.04 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.76 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |