C39H36N2O7S — CID 6690504
4-[[(2R,4R,5S,6S)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[3-[(4-phenoxyphenyl)carbamoylamino]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6690504) has the molecular formula C39H36N2O7S and a molecular weight of 676.79 g/mol. Its IUPAC name is 4-[[(2R,4R,5S,6S)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[3-[(4-phenoxyphenyl)carbamoylamino]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2R,4R,5S,6S)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[3-[(4-phenoxyphenyl)carbamoylamino]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6690504 |
| Molecular Formula | C39H36N2O7S |
| Molecular Weight | 676.79 g/mol |
| Exact Mass | 676.22 |
| IUPAC Name | 4-[[(2R,4R,5S,6S)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[3-[(4-phenoxyphenyl)carbamoylamino]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)Nc3ccc(Oc4ccccc4)cc3)c2)O[C@H]1CSc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C39H36N2O7S/c1-25-35(24-49-34-20-14-28(15-21-34)37(43)44)47-38(48-36(25)27-12-10-26(23-42)11-13-27)29-6-5-7-31(22-29)41-39(45)40-30-16-18-33(19-17-30)46-32-8-3-2-4-9-32/h2-22,25,35-36,38,42H,23-24H2,1H3,(H,43,44)(H2,40,41,45)/t25-,35+,36?,38+/m1/s1 |
| InChIKey | DBLRNJMWHIDDGK-AIXPVSLRSA-N |
| XLogP | 8.90 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.79 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |