C39H35N3O5S2 — CID 6685333
1-[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea (PubChem CID 6685333) has the molecular formula C39H35N3O5S2 and a molecular weight of 689.86 g/mol. Its IUPAC name is 1-[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 6685333 |
| Molecular Formula | C39H35N3O5S2 |
| Molecular Weight | 689.86 g/mol |
| Exact Mass | 689.20 |
| IUPAC Name | 1-[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea |
| SMILES | C[C@H]1[C@@H](CSc2nc3ccccc3s2)O[C@@H](c2cccc(NC(=O)Nc3ccc(Oc4ccccc4)cc3)c2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C39H35N3O5S2/c1-25-34(24-48-39-42-33-12-5-6-13-35(33)49-39)46-37(47-36(25)27-16-14-26(23-43)15-17-27)28-8-7-9-30(22-28)41-38(44)40-29-18-20-32(21-19-29)45-31-10-3-2-4-11-31/h2-22,25,34,36-37,43H,23-24H2,1H3,(H2,40,41,44)/t25-,34+,36+,37+/m0/s1 |
| InChIKey | XCOUXHSOSLPHQT-UMCUWAQZSA-N |
| XLogP | 9.81 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.86 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |