C41H39N3O4S2 — CID 6691172
1-[[3-[3-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-benzylurea (PubChem CID 6691172) has the molecular formula C41H39N3O4S2 and a molecular weight of 701.91 g/mol. Its IUPAC name is 1-[[3-[3-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-benzylurea.
| Compound Name | 1-[[3-[3-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-benzylurea |
|---|---|
| PubChem CID | 6691172 |
| Molecular Formula | C41H39N3O4S2 |
| Molecular Weight | 701.91 g/mol |
| Exact Mass | 701.24 |
| IUPAC Name | 1-[[3-[3-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-benzylurea |
| SMILES | C[C@@H]1[C@H](CSc2nc3ccccc3s2)O[C@H](c2cccc(-c3cccc(CNC(=O)NCc4ccccc4)c3)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C41H39N3O4S2/c1-27-36(26-49-41-44-35-15-5-6-16-37(35)50-41)47-39(48-38(27)31-19-17-29(25-45)18-20-31)34-14-8-13-33(22-34)32-12-7-11-30(21-32)24-43-40(46)42-23-28-9-3-2-4-10-28/h2-22,27,36,38-39,45H,23-26H2,1H3,(H2,42,43,46)/t27-,36+,38+,39+/m1/s1 |
| InChIKey | TYQSUWKGHNZZJW-MEFMFIILSA-N |
| XLogP | 9.04 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.91 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |