C40H36N2O4S2 — CID 6691153
N-[[3-[3-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6691153) has the molecular formula C40H36N2O4S2 and a molecular weight of 672.87 g/mol. Its IUPAC name is N-[[3-[3-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | N-[[3-[3-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6691153 |
| Molecular Formula | C40H36N2O4S2 |
| Molecular Weight | 672.87 g/mol |
| Exact Mass | 672.21 |
| IUPAC Name | N-[[3-[3-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | C[C@@H]1[C@H](CSc2nc3ccccc3s2)O[C@H](c2cccc(-c3cccc(CNC(=O)c4ccccc4)c3)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C40H36N2O4S2/c1-26-35(25-47-40-42-34-15-5-6-16-36(34)48-40)45-39(46-37(26)29-19-17-27(24-43)18-20-29)33-14-8-13-32(22-33)31-12-7-9-28(21-31)23-41-38(44)30-10-3-2-4-11-30/h2-22,26,35,37,39,43H,23-25H2,1H3,(H,41,44)/t26-,35+,37+,39+/m1/s1 |
| InChIKey | TYKGQGIBHPFHHD-LEIZTAGHSA-N |
| XLogP | 8.97 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.87 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |