C33H32N2O3S2 — CID 6685359
[4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-6-(1,3-benzothiazol-2-ylsulfanylmethyl)-5-methyl-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6685359) has the molecular formula C33H32N2O3S2 and a molecular weight of 568.76 g/mol. Its IUPAC name is [4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-6-(1,3-benzothiazol-2-ylsulfanylmethyl)-5-methyl-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-6-(1,3-benzothiazol-2-ylsulfanylmethyl)-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6685359 |
| Molecular Formula | C33H32N2O3S2 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | [4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-6-(1,3-benzothiazol-2-ylsulfanylmethyl)-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | C[C@H]1[C@@H](CSc2nc3ccccc3s2)O[C@@H](c2ccc(-c3cccc(CN)c3)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C33H32N2O3S2/c1-21-29(20-39-33-35-28-7-2-3-8-30(28)40-33)37-32(38-31(21)25-11-9-22(19-36)10-12-25)26-15-13-24(14-16-26)27-6-4-5-23(17-27)18-34/h2-17,21,29,31-32,36H,18-20,34H2,1H3/t21-,29+,31+,32+/m0/s1 |
| InChIKey | LLNOBFCONZKZME-LAKVWAJESA-N |
| XLogP | 7.50 |
| TPSA | 77.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |