C29H31N3O3S2 — CID 6689541
[4-[(2R,4S,5S,6R)-2-[3-[3-(aminomethyl)phenyl]phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6689541) has the molecular formula C29H31N3O3S2 and a molecular weight of 533.72 g/mol. Its IUPAC name is [4-[(2R,4S,5S,6R)-2-[3-[3-(aminomethyl)phenyl]phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(2R,4S,5S,6R)-2-[3-[3-(aminomethyl)phenyl]phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6689541 |
| Molecular Formula | C29H31N3O3S2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | [4-[(2R,4S,5S,6R)-2-[3-[3-(aminomethyl)phenyl]phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | Cc1nnc(SC[C@@H]2O[C@H](c3cccc(-c4cccc(CN)c4)c3)OC(c3ccc(CO)cc3)[C@@H]2C)s1 |
| InChI | InChI=1S/C29H31N3O3S2/c1-18-26(17-36-29-32-31-19(2)37-29)34-28(35-27(18)22-11-9-20(16-33)10-12-22)25-8-4-7-24(14-25)23-6-3-5-21(13-23)15-30/h3-14,18,26-28,33H,15-17,30H2,1-2H3/t18-,26+,27?,28+/m1/s1 |
| InChIKey | MESCDSLVRUHEBM-VCAGSELQSA-N |
| XLogP | 6.05 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |