C34H28N2O5S2 — CID 6705845
2-[4-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 6705845) has the molecular formula C34H28N2O5S2 and a molecular weight of 608.74 g/mol. Its IUPAC name is 2-[4-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6705845 |
| Molecular Formula | C34H28N2O5S2 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | 2-[4-[(2R,4R,5S,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | C[C@@H]1[C@H](CSc2nc3ccccc3s2)O[C@H](c2ccc(N3C(=O)c4ccccc4C3=O)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C34H28N2O5S2/c1-20-28(19-42-34-35-27-8-4-5-9-29(27)43-34)40-33(41-30(20)22-12-10-21(18-37)11-13-22)23-14-16-24(17-15-23)36-31(38)25-6-2-3-7-26(25)32(36)39/h2-17,20,28,30,33,37H,18-19H2,1H3/t20-,28+,30+,33+/m1/s1 |
| InChIKey | WSTNFHGBIRQJDZ-DMGZJMQRSA-N |
| XLogP | 7.17 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|