C31H29N3O5S — CID 6705361
2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 6705361) has the molecular formula C31H29N3O5S and a molecular weight of 555.66 g/mol. Its IUPAC name is 2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6705361 |
| Molecular Formula | C31H29N3O5S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | C[C@@H]1[C@H](CSc2nccn2C)O[C@H](c2ccc(N3C(=O)c4ccccc4C3=O)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C31H29N3O5S/c1-19-26(18-40-31-32-15-16-33(31)2)38-30(39-27(19)21-9-7-20(17-35)8-10-21)22-11-13-23(14-12-22)34-28(36)24-5-3-4-6-25(24)29(34)37/h3-16,19,26-27,30,35H,17-18H2,1-2H3/t19-,26+,27+,30+/m1/s1 |
| InChIKey | QXTRJMYLSUGXQE-LMFMVEJNSA-N |
| XLogP | 5.30 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|