C35H44N4O4S — CID 6688573
1-(1-adamantyl)-3-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]urea (PubChem CID 6688573) has the molecular formula C35H44N4O4S and a molecular weight of 616.83 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6688573 |
| Molecular Formula | C35H44N4O4S |
| Molecular Weight | 616.83 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | 1-(1-adamantyl)-3-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]urea |
| SMILES | C[C@@H]1[C@H](CSc2nccn2C)O[C@H](c2ccc(CNC(=O)NC34CC5CC(CC(C5)C3)C4)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C35H44N4O4S/c1-22-30(21-44-34-36-11-12-39(34)2)42-32(43-31(22)28-7-5-24(20-40)6-8-28)29-9-3-23(4-10-29)19-37-33(41)38-35-16-25-13-26(17-35)15-27(14-25)18-35/h3-12,22,25-27,30-32,40H,13-21H2,1-2H3,(H2,37,38,41)/t22-,25?,26?,27?,30+,31+,32+,35?/m1/s1 |
| InChIKey | LEFHEBOWDAFSGB-ASDFVHIMSA-N |
| XLogP | 6.26 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.83 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |