C38H44N6O4S — CID 6685817
1-(1-adamantyl)-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]urea (PubChem CID 6685817) has the molecular formula C38H44N6O4S and a molecular weight of 680.88 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6685817 |
| Molecular Formula | C38H44N6O4S |
| Molecular Weight | 680.88 g/mol |
| Exact Mass | 680.31 |
| IUPAC Name | 1-(1-adamantyl)-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]urea |
| SMILES | C[C@H]1[C@@H](CSc2nnnn2-c2ccccc2)O[C@@H](c2ccc(CNC(=O)NC34CC5CC(CC(C5)C3)C4)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C38H44N6O4S/c1-24-33(23-49-37-41-42-43-44(37)32-5-3-2-4-6-32)47-35(48-34(24)30-11-9-26(22-45)10-12-30)31-13-7-25(8-14-31)21-39-36(46)40-38-18-27-15-28(19-38)17-29(16-27)20-38/h2-14,24,27-29,33-35,45H,15-23H2,1H3,(H2,39,40,46)/t24-,27?,28?,29?,33+,34+,35+,38?/m0/s1 |
| InChIKey | YKCQQYANSKTOAA-OQRSGWQMSA-N |
| XLogP | 6.51 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.88 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |