C38H44N2O6S — CID 6684783
4-[[(2S,4S,5R,6R)-2-[4-[(1-adamantylcarbamoylamino)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6684783) has the molecular formula C38H44N2O6S and a molecular weight of 656.85 g/mol. Its IUPAC name is 4-[[(2S,4S,5R,6R)-2-[4-[(1-adamantylcarbamoylamino)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2S,4S,5R,6R)-2-[4-[(1-adamantylcarbamoylamino)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6684783 |
| Molecular Formula | C38H44N2O6S |
| Molecular Weight | 656.85 g/mol |
| Exact Mass | 656.29 |
| IUPAC Name | 4-[[(2S,4S,5R,6R)-2-[4-[(1-adamantylcarbamoylamino)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | C[C@H]1[C@@H](CSc2ccc(C(=O)O)cc2)O[C@@H](c2ccc(CNC(=O)NC34CC5CC(CC(C5)C3)C4)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C38H44N2O6S/c1-23-33(22-47-32-12-10-30(11-13-32)35(42)43)45-36(46-34(23)29-6-4-25(21-41)5-7-29)31-8-2-24(3-9-31)20-39-37(44)40-38-17-26-14-27(18-38)16-28(15-26)19-38/h2-13,23,26-28,33-34,36,41H,14-22H2,1H3,(H,42,43)(H2,39,40,44)/t23-,26?,27?,28?,33+,34+,36+,38?/m0/s1 |
| InChIKey | JCRAMGQPALVKQU-RTFRGZSKSA-N |
| XLogP | 7.23 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.85 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |